C28H38N6O5Si — CID 58992499
1-[9-[(2S,3aS,4R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]-3-ethylurea (PubChem CID 58992499) has the molecular formula C28H38N6O5Si and a molecular weight of 566.74 g/mol. Its IUPAC name is 1-[9-[(2S,3aS,4R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]-3-ethylurea.
| Compound Name | 1-[9-[(2S,3aS,4R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]-3-ethylurea |
|---|---|
| PubChem CID | 58992499 |
| Molecular Formula | C28H38N6O5Si |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | 1-[9-[(2S,3aS,4R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)C2O[C@H](/C=C/c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C28H38N6O5Si/c1-7-29-27(35)33-24-21-25(31-16-30-24)34(17-32-21)26-23-22(19(37-26)15-36-40(5,6)28(2,3)4)38-20(39-23)14-13-18-11-9-8-10-12-18/h8-14,16-17,19-20,22-23,26H,7,15H2,1-6H3,(H2,29,30,31,33,35)/b14-13+/t19-,20+,22?,23+,26-/m1/s1 |
| InChIKey | SXRWASITGHMUBY-BRAXDVJXSA-N |
| XLogP | 4.71 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|