C30H30N6O7 — CID 11962240
2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-3-methylbenzoic acid (PubChem CID 11962240) has the molecular formula C30H30N6O7 and a molecular weight of 586.61 g/mol. Its IUPAC name is 2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-3-methylbenzoic acid.
| Compound Name | 2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 11962240 |
| Molecular Formula | C30H30N6O7 |
| Molecular Weight | 586.61 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | 2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-3-methylbenzoic acid |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1OC(COc2c(C)cccc2C(=O)O)C2O[C@H](/C=C/c3ccccc3)OC21 |
| InChI | InChI=1S/C30H30N6O7/c1-3-31-30(39)35-26-22-27(33-15-32-26)36(16-34-22)28-25-24(42-21(43-25)13-12-18-9-5-4-6-10-18)20(41-28)14-40-23-17(2)8-7-11-19(23)29(37)38/h4-13,15-16,20-21,24-25,28H,3,14H2,1-2H3,(H,37,38)(H2,31,32,33,35,39)/b13-12+/t20?,21-,24?,25?,28?/m0/s1 |
| InChIKey | IZSRKEZKHTXVDW-BRPJUFLUSA-N |
| XLogP | 3.77 |
| TPSA | 158.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.61 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |