C30H30N6O8 — CID 91198678
2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-3-methoxybenzoic acid (PubChem CID 91198678) has the molecular formula C30H30N6O8 and a molecular weight of 602.60 g/mol. Its IUPAC name is 2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-3-methoxybenzoic acid.
| Compound Name | 2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 91198678 |
| Molecular Formula | C30H30N6O8 |
| Molecular Weight | 602.60 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | 2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-3-methoxybenzoic acid |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1OC(COc2c(OC)cccc2C(=O)O)C2O[C@H](C=Cc3ccccc3)OC21 |
| InChI | InChI=1S/C30H30N6O8/c1-3-31-30(39)35-26-22-27(33-15-32-26)36(16-34-22)28-25-24(43-21(44-25)13-12-17-8-5-4-6-9-17)20(42-28)14-41-23-18(29(37)38)10-7-11-19(23)40-2/h4-13,15-16,20-21,24-25,28H,3,14H2,1-2H3,(H,37,38)(H2,31,32,33,35,39)/t20?,21-,24?,25?,28?/m0/s1 |
| InChIKey | OTNMHCXDKPFAMV-PBEGZAHNSA-N |
| XLogP | 3.47 |
| TPSA | 168.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.60 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |