C32H33N7O7 — CID 91262982
2-[2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]-2-oxoethyl]benzoic acid (PubChem CID 91262982) has the molecular formula C32H33N7O7 and a molecular weight of 627.66 g/mol. Its IUPAC name is 2-[2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]-2-oxoethyl]benzoic acid.
| Compound Name | 2-[2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 91262982 |
| Molecular Formula | C32H33N7O7 |
| Molecular Weight | 627.66 g/mol |
| Exact Mass | 627.24 |
| IUPAC Name | 2-[2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]-2-oxoethyl]benzoic acid |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1OC(CN(C)C(=O)Cc2ccccc2C(=O)O)C2O[C@H](C=Cc3ccccc3)OC21 |
| InChI | InChI=1S/C32H33N7O7/c1-3-33-32(43)37-28-25-29(35-17-34-28)39(18-36-25)30-27-26(45-24(46-27)14-13-19-9-5-4-6-10-19)22(44-30)16-38(2)23(40)15-20-11-7-8-12-21(20)31(41)42/h4-14,17-18,22,24,26-27,30H,3,15-16H2,1-2H3,(H,41,42)(H2,33,34,35,37,43)/t22?,24-,26?,27?,30?/m0/s1 |
| InChIKey | HWXOYJSZVIZCAU-AZPHQPEWSA-N |
| XLogP | 3.09 |
| TPSA | 170.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.66 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |