C25H28N6O6 — CID 69330522
methyl 3-[(2R,6aR)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]propanoate (PubChem CID 69330522) has the molecular formula C25H28N6O6 and a molecular weight of 508.54 g/mol. Its IUPAC name is methyl 3-[(2R,6aR)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]propanoate.
| Compound Name | methyl 3-[(2R,6aR)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]propanoate |
|---|---|
| PubChem CID | 69330522 |
| Molecular Formula | C25H28N6O6 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | methyl 3-[(2R,6aR)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]propanoate |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1OC(CCC(=O)OC)[C@H]2O[C@@H](C=Cc3ccccc3)OC12 |
| InChI | InChI=1S/C25H28N6O6/c1-3-26-25(33)30-22-19-23(28-13-27-22)31(14-29-19)24-21-20(16(35-24)10-11-17(32)34-2)36-18(37-21)12-9-15-7-5-4-6-8-15/h4-9,12-14,16,18,20-21,24H,3,10-11H2,1-2H3,(H2,26,27,28,30,33)/t16?,18-,20-,21?,24?/m1/s1 |
| InChIKey | IZRFKWPPYVOGHD-AKLOTSJXSA-N |
| XLogP | 2.64 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |