C24H28N6O6 — CID 59658973
ethyl 3-[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]propanoate (PubChem CID 59658973) has the molecular formula C24H28N6O6 and a molecular weight of 496.52 g/mol. Its IUPAC name is ethyl 3-[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]propanoate.
| Compound Name | ethyl 3-[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]propanoate |
|---|---|
| PubChem CID | 59658973 |
| Molecular Formula | C24H28N6O6 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | ethyl 3-[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]propanoate |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1OC(CCC(=O)OCC)C2O[C@H](c3ccccc3)OC21 |
| InChI | InChI=1S/C24H28N6O6/c1-3-25-24(32)29-20-17-21(27-12-26-20)30(13-28-17)22-19-18(15(34-22)10-11-16(31)33-4-2)35-23(36-19)14-8-6-5-7-9-14/h5-9,12-13,15,18-19,22-23H,3-4,10-11H2,1-2H3,(H2,25,26,27,29,32)/t15?,18?,19?,22?,23-/m0/s1 |
| InChIKey | IPULMCWWJBDUDV-JRPCQTRRSA-N |
| XLogP | 2.69 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |