C28H27ClN6O7 — CID 11962382
3-chloro-2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxymethyl]benzoic acid (PubChem CID 11962382) has the molecular formula C28H27ClN6O7 and a molecular weight of 595.01 g/mol. Its IUPAC name is 3-chloro-2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxymethyl]benzoic acid.
| Compound Name | 3-chloro-2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxymethyl]benzoic acid |
|---|---|
| PubChem CID | 11962382 |
| Molecular Formula | C28H27ClN6O7 |
| Molecular Weight | 595.01 g/mol |
| Exact Mass | 594.16 |
| IUPAC Name | 3-chloro-2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxymethyl]benzoic acid |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1OC(COCc2c(Cl)cccc2C(=O)O)C2O[C@H](c3ccccc3)OC21 |
| InChI | InChI=1S/C28H27ClN6O7/c1-2-30-28(38)34-23-20-24(32-13-31-23)35(14-33-20)25-22-21(41-27(42-22)15-7-4-3-5-8-15)19(40-25)12-39-11-17-16(26(36)37)9-6-10-18(17)29/h3-10,13-14,19,21-22,25,27H,2,11-12H2,1H3,(H,36,37)(H2,30,31,32,34,38)/t19?,21?,22?,25?,27-/m0/s1 |
| InChIKey | JYRAOAIGNHTTRV-CKKQJKQMSA-N |
| XLogP | 3.92 |
| TPSA | 158.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.01 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |