C32H33ClN6O7 — CID 91475268
ethyl 3-chloro-2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxymethyl]benzoate (PubChem CID 91475268) has the molecular formula C32H33ClN6O7 and a molecular weight of 649.10 g/mol. Its IUPAC name is ethyl 3-chloro-2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxymethyl]benzoate.
| Compound Name | ethyl 3-chloro-2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxymethyl]benzoate |
|---|---|
| PubChem CID | 91475268 |
| Molecular Formula | C32H33ClN6O7 |
| Molecular Weight | 649.10 g/mol |
| Exact Mass | 648.21 |
| IUPAC Name | ethyl 3-chloro-2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxymethyl]benzoate |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1OC(COCc2c(Cl)cccc2C(=O)OCC)C2O[C@H](C=Cc3ccccc3)OC21 |
| InChI | InChI=1S/C32H33ClN6O7/c1-3-34-32(41)38-28-25-29(36-17-35-28)39(18-37-25)30-27-26(45-24(46-27)14-13-19-9-6-5-7-10-19)23(44-30)16-42-15-21-20(31(40)43-4-2)11-8-12-22(21)33/h5-14,17-18,23-24,26-27,30H,3-4,15-16H2,1-2H3,(H2,34,35,36,38,41)/t23?,24-,26?,27?,30?/m0/s1 |
| InChIKey | HZCUACIBYLNFNK-FITXIGPMSA-N |
| XLogP | 4.74 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.10 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |