C30H31ClN6O7 — CID 11962461
ethyl 3-chloro-2-[[(2R)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxymethyl]benzoate (PubChem CID 11962461) has the molecular formula C30H31ClN6O7 and a molecular weight of 623.07 g/mol. Its IUPAC name is ethyl 3-chloro-2-[[(2R)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxymethyl]benzoate.
| Compound Name | ethyl 3-chloro-2-[[(2R)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxymethyl]benzoate |
|---|---|
| PubChem CID | 11962461 |
| Molecular Formula | C30H31ClN6O7 |
| Molecular Weight | 623.07 g/mol |
| Exact Mass | 622.19 |
| IUPAC Name | ethyl 3-chloro-2-[[(2R)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxymethyl]benzoate |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1OC(COCc2c(Cl)cccc2C(=O)OCC)C2O[C@@H](c3ccccc3)OC21 |
| InChI | InChI=1S/C30H31ClN6O7/c1-3-32-30(39)36-25-22-26(34-15-33-25)37(16-35-22)27-24-23(43-29(44-24)17-9-6-5-7-10-17)21(42-27)14-40-13-19-18(28(38)41-4-2)11-8-12-20(19)31/h5-12,15-16,21,23-24,27,29H,3-4,13-14H2,1-2H3,(H2,32,33,34,36,39)/t21?,23?,24?,27?,29-/m1/s1 |
| InChIKey | OYMYQDTZZNUNPO-ZSBIFVROSA-N |
| XLogP | 4.39 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.07 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |