C29H29N7O7 — CID 59659018
2-[2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylamino]-2-oxoethyl]benzoic acid (PubChem CID 59659018) has the molecular formula C29H29N7O7 and a molecular weight of 587.59 g/mol. Its IUPAC name is 2-[2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylamino]-2-oxoethyl]benzoic acid.
| Compound Name | 2-[2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylamino]-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 59659018 |
| Molecular Formula | C29H29N7O7 |
| Molecular Weight | 587.59 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | 2-[2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylamino]-2-oxoethyl]benzoic acid |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1OC(CNC(=O)Cc2ccccc2C(=O)O)C2O[C@H](c3ccccc3)OC21 |
| InChI | InChI=1S/C29H29N7O7/c1-2-30-29(40)35-24-21-25(33-14-32-24)36(15-34-21)26-23-22(42-28(43-23)16-8-4-3-5-9-16)19(41-26)13-31-20(37)12-17-10-6-7-11-18(17)27(38)39/h3-11,14-15,19,22-23,26,28H,2,12-13H2,1H3,(H,31,37)(H,38,39)(H2,30,32,33,35,40)/t19?,22?,23?,26?,28-/m0/s1 |
| InChIKey | OZGZTJALFCEUFX-DEQASYSKSA-N |
| XLogP | 2.40 |
| TPSA | 178.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.59 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |