C22H23N7O7 — CID 59659014
2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]amino]acetic acid (PubChem CID 59659014) has the molecular formula C22H23N7O7 and a molecular weight of 497.47 g/mol. Its IUPAC name is 2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]amino]acetic acid.
| Compound Name | 2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 59659014 |
| Molecular Formula | C22H23N7O7 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]amino]acetic acid |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1OC(C(=O)NCC(=O)O)C2O[C@H](c3ccccc3)OC21 |
| InChI | InChI=1S/C22H23N7O7/c1-2-23-22(33)28-17-13-18(26-9-25-17)29(10-27-13)20-16-14(15(34-20)19(32)24-8-12(30)31)35-21(36-16)11-6-4-3-5-7-11/h3-7,9-10,14-16,20-21H,2,8H2,1H3,(H,24,32)(H,30,31)(H2,23,25,26,28,33)/t14?,15?,16?,20?,21-/m0/s1 |
| InChIKey | KZSQFPLIWBZCKN-NQHKGHKJSA-N |
| XLogP | 0.55 |
| TPSA | 178.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |