C21H22N6O6 — CID 69302874
2-[4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetic acid (PubChem CID 69302874) has the molecular formula C21H22N6O6 and a molecular weight of 454.44 g/mol. Its IUPAC name is 2-[4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetic acid.
| Compound Name | 2-[4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetic acid |
|---|---|
| PubChem CID | 69302874 |
| Molecular Formula | C21H22N6O6 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 2-[4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetic acid |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1OC(CC(=O)O)C2OC(c3ccccc3)OC21 |
| InChI | InChI=1S/C21H22N6O6/c1-2-22-21(30)26-17-14-18(24-9-23-17)27(10-25-14)19-16-15(12(31-19)8-13(28)29)32-20(33-16)11-6-4-3-5-7-11/h3-7,9-10,12,15-16,19-20H,2,8H2,1H3,(H,28,29)(H2,22,23,24,26,30) |
| InChIKey | OQKXFGJTSVCMEA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 149.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |