C22H27N7O7P- — CID 59812568
[(2R,3aS,4R,6R)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-(2-aminoethyl)phosphinate (PubChem CID 59812568) has the molecular formula C22H27N7O7P- and a molecular weight of 532.47 g/mol. Its IUPAC name is [(2R,3aS,4R,6R)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-(2-aminoethyl)phosphinate.
| Compound Name | [(2R,3aS,4R,6R)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-(2-aminoethyl)phosphinate |
|---|---|
| PubChem CID | 59812568 |
| Molecular Formula | C22H27N7O7P- |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | [(2R,3aS,4R,6R)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-(2-aminoethyl)phosphinate |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])CCN)C2O[C@@H](c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C22H28N7O7P/c1-2-24-22(30)28-18-15-19(26-11-25-18)29(12-27-15)20-17-16(14(34-20)10-33-37(31,32)9-8-23)35-21(36-17)13-6-4-3-5-7-13/h3-7,11-12,14,16-17,20-21H,2,8-10,23H2,1H3,(H,31,32)(H2,24,25,26,28,30)/p-1/t14-,16?,17+,20-,21-/m1/s1 |
| InChIKey | WLNFUVVLMBZHNN-DBFMNVRJSA-M |
| XLogP | 0.88 |
| TPSA | 187.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|