C24H31N6O8P — CID 58735006
[(4R,6R,6aS)-4-[6-(hexylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate (PubChem CID 58735006) has the molecular formula C24H31N6O8P and a molecular weight of 562.52 g/mol. Its IUPAC name is [(4R,6R,6aS)-4-[6-(hexylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate.
| Compound Name | [(4R,6R,6aS)-4-[6-(hexylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 58735006 |
| Molecular Formula | C24H31N6O8P |
| Molecular Weight | 562.52 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | [(4R,6R,6aS)-4-[6-(hexylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate |
| SMILES | CCCCCCNC(=O)Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H]2OC(c3ccccc3)OC21 |
| InChI | InChI=1S/C24H31N6O8P/c1-2-3-4-8-11-25-24(31)29-20-17-21(27-13-26-20)30(14-28-17)22-19-18(16(36-22)12-35-39(32,33)34)37-23(38-19)15-9-6-5-7-10-15/h5-7,9-10,13-14,16,18-19,22-23H,2-4,8,11-12H2,1H3,(H2,32,33,34)(H2,25,26,27,29,31)/t16-,18+,19?,22-,23?/m1/s1 |
| InChIKey | YNMMDJLFVHXJMJ-HKKQGIOSSA-N |
| XLogP | 3.02 |
| TPSA | 179.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|