C23H25N6O8P — CID 58735022
[(4R,6R,6aS)-2-(2-phenylethynyl)-4-[6-(propylcarbamoylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate (PubChem CID 58735022) has the molecular formula C23H25N6O8P and a molecular weight of 544.46 g/mol. Its IUPAC name is [(4R,6R,6aS)-2-(2-phenylethynyl)-4-[6-(propylcarbamoylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate.
| Compound Name | [(4R,6R,6aS)-2-(2-phenylethynyl)-4-[6-(propylcarbamoylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 58735022 |
| Molecular Formula | C23H25N6O8P |
| Molecular Weight | 544.46 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | [(4R,6R,6aS)-2-(2-phenylethynyl)-4-[6-(propylcarbamoylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate |
| SMILES | CCCNC(=O)Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H]2OC(C#Cc3ccccc3)OC21 |
| InChI | InChI=1S/C23H25N6O8P/c1-2-10-24-23(30)28-20-17-21(26-12-25-20)29(13-27-17)22-19-18(15(35-22)11-34-38(31,32)33)36-16(37-19)9-8-14-6-4-3-5-7-14/h3-7,12-13,15-16,18-19,22H,2,10-11H2,1H3,(H2,31,32,33)(H2,24,25,26,28,30)/t15-,16?,18+,19?,22-/m1/s1 |
| InChIKey | GXAHWIKZHDPDOJ-OFWQPKEXSA-N |
| XLogP | 1.53 |
| TPSA | 179.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.46 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|