C21H24N6O8P- — CID 59834250
[(3aS,4R,6R)-2-phenyl-4-[6-(propylcarbamoylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl hydrogen phosphate (PubChem CID 59834250) has the molecular formula C21H24N6O8P- and a molecular weight of 519.43 g/mol. Its IUPAC name is [(3aS,4R,6R)-2-phenyl-4-[6-(propylcarbamoylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl hydrogen phosphate.
| Compound Name | [(3aS,4R,6R)-2-phenyl-4-[6-(propylcarbamoylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 59834250 |
| Molecular Formula | C21H24N6O8P- |
| Molecular Weight | 519.43 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | [(3aS,4R,6R)-2-phenyl-4-[6-(propylcarbamoylamino)purin-9-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl hydrogen phosphate |
| SMILES | CCCNC(=O)Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])O)C2OC(c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C21H25N6O8P/c1-2-8-22-21(28)26-17-14-18(24-10-23-17)27(11-25-14)19-16-15(13(33-19)9-32-36(29,30)31)34-20(35-16)12-6-4-3-5-7-12/h3-7,10-11,13,15-16,19-20H,2,8-9H2,1H3,(H2,29,30,31)(H2,22,23,24,26,28)/p-1/t13-,15?,16+,19-,20?/m1/s1 |
| InChIKey | LEODZRABHOUNEP-MQVXJBGWSA-M |
| XLogP | 1.22 |
| TPSA | 182.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|