C29H26FN7O7 — CID 91571968
2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]amino]-3-fluorobenzoic acid (PubChem CID 91571968) has the molecular formula C29H26FN7O7 and a molecular weight of 603.57 g/mol. Its IUPAC name is 2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]amino]-3-fluorobenzoic acid.
| Compound Name | 2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]amino]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 91571968 |
| Molecular Formula | C29H26FN7O7 |
| Molecular Weight | 603.57 g/mol |
| Exact Mass | 603.19 |
| IUPAC Name | 2-[[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]amino]-3-fluorobenzoic acid |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1OC(C(=O)Nc2c(F)cccc2C(=O)O)C2O[C@H](C=Cc3ccccc3)OC21 |
| InChI | InChI=1S/C29H26FN7O7/c1-2-31-29(41)36-24-20-25(33-13-32-24)37(14-34-20)27-23-21(42-18(43-23)12-11-15-7-4-3-5-8-15)22(44-27)26(38)35-19-16(28(39)40)9-6-10-17(19)30/h3-14,18,21-23,27H,2H2,1H3,(H,35,38)(H,39,40)(H2,31,32,33,36,41)/t18-,21?,22?,23?,27?/m0/s1 |
| InChIKey | NQWMDYHUKNESFA-KXEBGOAGSA-N |
| XLogP | 3.16 |
| TPSA | 178.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |