C31H31FN6O5 — CID 59659028
2-[2-[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]ethyl]-3-fluorobenzoic acid (PubChem CID 59659028) has the molecular formula C31H31FN6O5 and a molecular weight of 586.62 g/mol. Its IUPAC name is 2-[2-[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]ethyl]-3-fluorobenzoic acid.
| Compound Name | 2-[2-[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]ethyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 59659028 |
| Molecular Formula | C31H31FN6O5 |
| Molecular Weight | 586.62 g/mol |
| Exact Mass | 586.23 |
| IUPAC Name | 2-[2-[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]ethyl]-3-fluorobenzoic acid |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1CC(CCc2c(F)cccc2C(=O)O)C2O[C@H](/C=C/c3ccccc3)OC21 |
| InChI | InChI=1S/C31H31FN6O5/c1-2-33-31(41)37-28-25-29(35-16-34-28)38(17-36-25)23-15-19(12-13-20-21(30(39)40)9-6-10-22(20)32)26-27(23)43-24(42-26)14-11-18-7-4-3-5-8-18/h3-11,14,16-17,19,23-24,26-27H,2,12-13,15H2,1H3,(H,39,40)(H2,33,34,35,37,41)/b14-11+/t19?,23?,24-,26?,27?/m0/s1 |
| InChIKey | XGROUVGHUDBYAG-TXDMQYRPSA-N |
| XLogP | 4.82 |
| TPSA | 140.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.62 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |