C31H31N7O6 — CID 68744573
2-[[(2R,6aR)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methylcarbamoyl]benzoic acid (PubChem CID 68744573) has the molecular formula C31H31N7O6 and a molecular weight of 597.63 g/mol. Its IUPAC name is 2-[[(2R,6aR)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methylcarbamoyl]benzoic acid.
| Compound Name | 2-[[(2R,6aR)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methylcarbamoyl]benzoic acid |
|---|---|
| PubChem CID | 68744573 |
| Molecular Formula | C31H31N7O6 |
| Molecular Weight | 597.63 g/mol |
| Exact Mass | 597.23 |
| IUPAC Name | 2-[[(2R,6aR)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methylcarbamoyl]benzoic acid |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1CC(CNC(=O)c2ccccc2C(=O)O)[C@H]2O[C@@H](C=Cc3ccccc3)OC12 |
| InChI | InChI=1S/C31H31N7O6/c1-2-32-31(42)37-27-24-28(35-16-34-27)38(17-36-24)22-14-19(15-33-29(39)20-10-6-7-11-21(20)30(40)41)25-26(22)44-23(43-25)13-12-18-8-4-3-5-9-18/h3-13,16-17,19,22-23,25-26H,2,14-15H2,1H3,(H,33,39)(H,40,41)(H2,32,34,35,37,42)/t19?,22?,23-,25-,26?/m1/s1 |
| InChIKey | FZXHXTHTQVNLHU-XALDFVHOSA-N |
| XLogP | 3.48 |
| TPSA | 169.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.63 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |