C28H26N6O7 — CID 59720340
2-[[(2R)-6-[6-(ethylcarbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]oxy]benzoic acid (PubChem CID 59720340) has the molecular formula C28H26N6O7 and a molecular weight of 558.55 g/mol. Its IUPAC name is 2-[[(2R)-6-[6-(ethylcarbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]oxy]benzoic acid.
| Compound Name | 2-[[(2R)-6-[6-(ethylcarbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]oxy]benzoic acid |
|---|---|
| PubChem CID | 59720340 |
| Molecular Formula | C28H26N6O7 |
| Molecular Weight | 558.55 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | 2-[[(2R)-6-[6-(ethylcarbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]oxy]benzoic acid |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1OC(Oc2ccccc2C(=O)O)C2O[C@H](/C=C/c3ccccc3)OC21 |
| InChI | InChI=1S/C28H26N6O7/c1-2-29-28(37)33-23-20-24(31-14-30-23)34(15-32-20)25-21-22(40-19(39-21)13-12-16-8-4-3-5-9-16)27(41-25)38-18-11-7-6-10-17(18)26(35)36/h3-15,19,21-22,25,27H,2H2,1H3,(H,35,36)(H2,29,30,31,33,37)/b13-12+/t19-,21?,22?,25?,27?/m1/s1 |
| InChIKey | VEGJXDRXVKCPDK-OTJCLBLUSA-N |
| XLogP | 3.42 |
| TPSA | 158.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.55 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |