C27H29N7O7 — CID 91197341
(2S)-1-[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 91197341) has the molecular formula C27H29N7O7 and a molecular weight of 563.57 g/mol. Its IUPAC name is (2S)-1-[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 91197341 |
| Molecular Formula | C27H29N7O7 |
| Molecular Weight | 563.57 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | (2S)-1-[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1OC(C(=O)N2CCC[C@H]2C(=O)O)C2O[C@H](C=Cc3ccccc3)OC21 |
| InChI | InChI=1S/C27H29N7O7/c1-2-28-27(38)32-22-18-23(30-13-29-22)34(14-31-18)25-21-19(39-17(40-21)11-10-15-7-4-3-5-8-15)20(41-25)24(35)33-12-6-9-16(33)26(36)37/h3-5,7-8,10-11,13-14,16-17,19-21,25H,2,6,9,12H2,1H3,(H,36,37)(H2,28,29,30,32,38)/t16-,17-,19?,20?,21?,25?/m0/s1 |
| InChIKey | JRENORGAJOIYJB-SUMQHHKZSA-N |
| XLogP | 1.76 |
| TPSA | 170.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.57 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |