C29H33N7O7 — CID 91423442
ethyl (2S)-1-[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]pyrrolidine-2-carboxylate (PubChem CID 91423442) has the molecular formula C29H33N7O7 and a molecular weight of 591.63 g/mol. Its IUPAC name is ethyl (2S)-1-[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S)-1-[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 91423442 |
| Molecular Formula | C29H33N7O7 |
| Molecular Weight | 591.63 g/mol |
| Exact Mass | 591.24 |
| IUPAC Name | ethyl (2S)-1-[(2S)-4-[6-(ethylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbonyl]pyrrolidine-2-carboxylate |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2C1OC(C(=O)N2CCC[C@H]2C(=O)OCC)C2O[C@H](C=Cc3ccccc3)OC21 |
| InChI | InChI=1S/C29H33N7O7/c1-3-30-29(39)34-24-20-25(32-15-31-24)36(16-33-20)27-23-21(41-19(42-23)13-12-17-9-6-5-7-10-17)22(43-27)26(37)35-14-8-11-18(35)28(38)40-4-2/h5-7,9-10,12-13,15-16,18-19,21-23,27H,3-4,8,11,14H2,1-2H3,(H2,30,31,32,34,39)/t18-,19-,21?,22?,23?,27?/m0/s1 |
| InChIKey | CIMZBPYRAXDLCL-QSPJPPEZSA-N |
| XLogP | 2.24 |
| TPSA | 159.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.63 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |