C20H21N6O8P — CID 89358884
[(2S,4R,6R,6aS)-4-[6-(carbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate (PubChem CID 89358884) has the molecular formula C20H21N6O8P and a molecular weight of 504.40 g/mol. Its IUPAC name is [(2S,4R,6R,6aS)-4-[6-(carbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate.
| Compound Name | [(2S,4R,6R,6aS)-4-[6-(carbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 89358884 |
| Molecular Formula | C20H21N6O8P |
| Molecular Weight | 504.40 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | [(2S,4R,6R,6aS)-4-[6-(carbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dihydrogen phosphate |
| SMILES | NC(=O)Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H]2O[C@H](/C=C/c3ccccc3)OC21 |
| InChI | InChI=1S/C20H21N6O8P/c21-20(27)25-17-14-18(23-9-22-17)26(10-24-14)19-16-15(12(32-19)8-31-35(28,29)30)33-13(34-16)7-6-11-4-2-1-3-5-11/h1-7,9-10,12-13,15-16,19H,8H2,(H2,28,29,30)(H3,21,22,23,25,27)/b7-6+/t12-,13+,15+,16?,19-/m1/s1 |
| InChIKey | BEAHLPQLHFGDMB-MZHFQWSFSA-N |
| XLogP | 1.15 |
| TPSA | 193.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|