C30H28N6O7 — CID 11962789
2-[[(2S)-4-[6-(cyclopropylcarbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]benzoic acid (PubChem CID 11962789) has the molecular formula C30H28N6O7 and a molecular weight of 584.59 g/mol. Its IUPAC name is 2-[[(2S)-4-[6-(cyclopropylcarbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]benzoic acid.
| Compound Name | 2-[[(2S)-4-[6-(cyclopropylcarbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 11962789 |
| Molecular Formula | C30H28N6O7 |
| Molecular Weight | 584.59 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | 2-[[(2S)-4-[6-(cyclopropylcarbamoylamino)purin-9-yl]-2-[(E)-2-phenylethenyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]benzoic acid |
| SMILES | O=C(Nc1ncnc2c1ncn2C1OC(COc2ccccc2C(=O)O)C2O[C@H](/C=C/c3ccccc3)OC21)NC1CC1 |
| InChI | InChI=1S/C30H28N6O7/c37-29(38)19-8-4-5-9-20(19)40-14-21-24-25(43-22(42-24)13-10-17-6-2-1-3-7-17)28(41-21)36-16-33-23-26(31-15-32-27(23)36)35-30(39)34-18-11-12-18/h1-10,13,15-16,18,21-22,24-25,28H,11-12,14H2,(H,37,38)(H2,31,32,34,35,39)/b13-10+/t21?,22-,24?,25?,28?/m0/s1 |
| InChIKey | ZNHVYZJHBUSWFT-ANNZFTPJSA-N |
| XLogP | 3.61 |
| TPSA | 158.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.59 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |