C34H31N7O6 — CID 90946107
2-[[[(2S,3aS,4R,6R)-4-[6-(phenylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylamino]methyl]benzoic acid (PubChem CID 90946107) has the molecular formula C34H31N7O6 and a molecular weight of 633.67 g/mol. Its IUPAC name is 2-[[[(2S,3aS,4R,6R)-4-[6-(phenylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylamino]methyl]benzoic acid.
| Compound Name | 2-[[[(2S,3aS,4R,6R)-4-[6-(phenylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 90946107 |
| Molecular Formula | C34H31N7O6 |
| Molecular Weight | 633.67 g/mol |
| Exact Mass | 633.23 |
| IUPAC Name | 2-[[[(2S,3aS,4R,6R)-4-[6-(phenylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylamino]methyl]benzoic acid |
| SMILES | O=C(Nc1ccccc1)Nc1ncnc2c1ncn2[C@@H]1O[C@H](CNCc2ccccc2C(=O)O)C2O[C@H](C=Cc3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C34H31N7O6/c42-33(43)24-14-8-7-11-22(24)17-35-18-25-28-29(47-26(46-28)16-15-21-9-3-1-4-10-21)32(45-25)41-20-38-27-30(36-19-37-31(27)41)40-34(44)39-23-12-5-2-6-13-23/h1-16,19-20,25-26,28-29,32,35H,17-18H2,(H,42,43)(H2,36,37,39,40,44)/t25-,26+,28?,29+,32-/m1/s1 |
| InChIKey | URICQZSFFINXFK-UUZVRKHDSA-N |
| XLogP | 4.68 |
| TPSA | 161.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.67 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |