C25H27N7O6 — CID 91528267
2-[[(2S)-4-[6-(cyclopropylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylamino]acetic acid (PubChem CID 91528267) has the molecular formula C25H27N7O6 and a molecular weight of 521.53 g/mol. Its IUPAC name is 2-[[(2S)-4-[6-(cyclopropylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylamino]acetic acid.
| Compound Name | 2-[[(2S)-4-[6-(cyclopropylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylamino]acetic acid |
|---|---|
| PubChem CID | 91528267 |
| Molecular Formula | C25H27N7O6 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | 2-[[(2S)-4-[6-(cyclopropylcarbamoylamino)purin-9-yl]-2-(2-phenylethenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylamino]acetic acid |
| SMILES | O=C(O)CNCC1OC(n2cnc3c(NC(=O)NC4CC4)ncnc32)C2O[C@@H](C=Cc3ccccc3)OC12 |
| InChI | InChI=1S/C25H27N7O6/c33-17(34)11-26-10-16-20-21(38-18(37-20)9-6-14-4-2-1-3-5-14)24(36-16)32-13-29-19-22(27-12-28-23(19)32)31-25(35)30-15-7-8-15/h1-6,9,12-13,15-16,18,20-21,24,26H,7-8,10-11H2,(H,33,34)(H2,27,28,30,31,35)/t16?,18-,20?,21?,24?/m0/s1 |
| InChIKey | LYKBNHFAUVYPJV-FNPJCYKXSA-N |
| XLogP | 1.51 |
| TPSA | 161.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |