C24H27N6Na2O6P — CID 58730451
disodium;[(1S,3R,3aS,5S)-3-[6-(ethylcarbamoylamino)purin-9-yl]-5-[(E)-2-phenylethenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-1-yl]methyl phosphate (PubChem CID 58730451) has the molecular formula C24H27N6Na2O6P and a molecular weight of 572.47 g/mol. Its IUPAC name is disodium;[(1S,3R,3aS,5S)-3-[6-(ethylcarbamoylamino)purin-9-yl]-5-[(E)-2-phenylethenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-1-yl]methyl phosphate.
| Compound Name | disodium;[(1S,3R,3aS,5S)-3-[6-(ethylcarbamoylamino)purin-9-yl]-5-[(E)-2-phenylethenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-1-yl]methyl phosphate |
|---|---|
| PubChem CID | 58730451 |
| Molecular Formula | C24H27N6Na2O6P |
| Molecular Weight | 572.47 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | disodium;[(1S,3R,3aS,5S)-3-[6-(ethylcarbamoylamino)purin-9-yl]-5-[(E)-2-phenylethenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-1-yl]methyl phosphate |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])[O-])C2C[C@H](/C=C/c3ccccc3)C[C@@H]21.[Na+].[Na+] |
| InChI | InChI=1S/C24H29N6O6P.2Na/c1-2-25-24(31)29-21-20-22(27-13-26-21)30(14-28-20)23-18-11-16(9-8-15-6-4-3-5-7-15)10-17(18)19(36-23)12-35-37(32,33)34;;/h3-9,13-14,16-19,23H,2,10-12H2,1H3,(H2,32,33,34)(H2,25,26,27,29,31);;/q;2*+1/p-2/b9-8+;;/t16-,17?,18-,19+,23+;;/m0../s1 |
| InChIKey | OGECOPZXHGSSIE-XMFWGNEMSA-L |
| XLogP | -3.93 |
| TPSA | 166.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.47 |
| LogP ≤ 5 | -3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|