C14H20N6O10P2-2 — CID 59812725
[[(2R,4S,5R)-5-[6-(ethylcarbamoylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-methylphosphinate (PubChem CID 59812725) has the molecular formula C14H20N6O10P2-2 and a molecular weight of 494.29 g/mol. Its IUPAC name is [[(2R,4S,5R)-5-[6-(ethylcarbamoylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-methylphosphinate.
| Compound Name | [[(2R,4S,5R)-5-[6-(ethylcarbamoylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-methylphosphinate |
|---|---|
| PubChem CID | 59812725 |
| Molecular Formula | C14H20N6O10P2-2 |
| Molecular Weight | 494.29 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | [[(2R,4S,5R)-5-[6-(ethylcarbamoylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-methylphosphinate |
| SMILES | CCNC(=O)Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OP(C)(=O)[O-])C(O)[C@@H]1O |
| InChI | InChI=1S/C14H22N6O10P2/c1-3-15-14(23)19-11-8-12(17-5-16-11)20(6-18-8)13-10(22)9(21)7(29-13)4-28-32(26,27)30-31(2,24)25/h5-7,9-10,13,21-22H,3-4H2,1-2H3,(H,24,25)(H,26,27)(H2,15,16,17,19,23)/p-2/t7-,9?,10+,13-/m1/s1 |
| InChIKey | SPHMGSSBUHNDHJ-CXOKJZQJSA-L |
| XLogP | -1.73 |
| TPSA | 233.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.29 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|