C22H40N6O14P2 — CID 57325913
N,N-diethylethanamine;[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 57325913) has the molecular formula C22H40N6O14P2 and a molecular weight of 674.54 g/mol. Its IUPAC name is N,N-diethylethanamine;[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | N,N-diethylethanamine;[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 57325913 |
| Molecular Formula | C22H40N6O14P2 |
| Molecular Weight | 674.54 g/mol |
| Exact Mass | 674.21 |
| IUPAC Name | N,N-diethylethanamine;[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | CCN(CC)CC.CNc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OC[C@H]2OC(O)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H25N5O14P2.C6H15N/c1-17-13-8-14(19-4-18-13)21(5-20-8)15-11(24)9(22)6(33-15)2-31-36(27,28)35-37(29,30)32-3-7-10(23)12(25)16(26)34-7;1-4-7(5-2)6-3/h4-7,9-12,15-16,22-26H,2-3H2,1H3,(H,27,28)(H,29,30)(H,17,18,19);4-6H2,1-3H3/t6-,7-,9-,10-,11-,12-,15-,16?;/m1./s1 |
| InChIKey | ZNCUDJJXXKEABE-BCCRKNIFSA-N |
| XLogP | -1.48 |
| TPSA | 280.77 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.54 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|