C17H31N6O13P3 — CID 154589639
[[(2R,3R,5R)-3,4-dihydroxy-5-[6-[6-(methylamino)hexylamino]purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 154589639) has the molecular formula C17H31N6O13P3 and a molecular weight of 620.39 g/mol. Its IUPAC name is [[(2R,3R,5R)-3,4-dihydroxy-5-[6-[6-(methylamino)hexylamino]purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,5R)-3,4-dihydroxy-5-[6-[6-(methylamino)hexylamino]purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 154589639 |
| Molecular Formula | C17H31N6O13P3 |
| Molecular Weight | 620.39 g/mol |
| Exact Mass | 620.12 |
| IUPAC Name | [[(2R,3R,5R)-3,4-dihydroxy-5-[6-[6-(methylamino)hexylamino]purin-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CNCCCCCCNc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H](O)C1O |
| InChI | InChI=1S/C17H31N6O13P3/c1-18-6-4-2-3-5-7-19-15-12-16(21-9-20-15)23(10-22-12)17-14(25)13(24)11(34-17)8-33-38(29,30)36-39(31,32)35-37(26,27)28/h9-11,13-14,17-18,24-25H,2-8H2,1H3,(H,29,30)(H,31,32)(H,19,20,21)(H2,26,27,28)/t11-,13+,14?,17-/m1/s1 |
| InChIKey | SILUSMUSOMUPTN-NUKIEUHSSA-N |
| XLogP | -0.02 |
| TPSA | 277.17 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.39 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|