C17H32N7O12P3 — CID 176826330
[[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-N-[6-(methylamino)hexyl]phosphonamidic acid (PubChem CID 176826330) has the molecular formula C17H32N7O12P3 and a molecular weight of 619.40 g/mol. Its IUPAC name is [[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-N-[6-(methylamino)hexyl]phosphonamidic acid.
| Compound Name | [[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-N-[6-(methylamino)hexyl]phosphonamidic acid |
|---|---|
| PubChem CID | 176826330 |
| Molecular Formula | C17H32N7O12P3 |
| Molecular Weight | 619.40 g/mol |
| Exact Mass | 619.13 |
| IUPAC Name | [[[(2R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-N-[6-(methylamino)hexyl]phosphonamidic acid |
| SMILES | CNCCCCCCNP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)C(O)C1O |
| InChI | InChI=1S/C17H32N7O12P3/c1-19-6-4-2-3-5-7-23-37(27,28)35-39(31,32)36-38(29,30)33-8-11-13(25)14(26)17(34-11)24-10-22-12-15(18)20-9-21-16(12)24/h9-11,13-14,17,19,25-26H,2-8H2,1H3,(H,29,30)(H,31,32)(H2,18,20,21)(H2,23,27,28)/t11-,13?,14?,17-/m1/s1 |
| InChIKey | YGAVGRCLBOINTN-PKNZVCHQSA-N |
| XLogP | -0.25 |
| TPSA | 282.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.40 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|