C14H21N6O12P3 — CID 45271110
[[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-N-but-3-ynylphosphonamidic acid (PubChem CID 45271110) has the molecular formula C14H21N6O12P3 and a molecular weight of 558.27 g/mol. Its IUPAC name is [[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-N-but-3-ynylphosphonamidic acid.
| Compound Name | [[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-N-but-3-ynylphosphonamidic acid |
|---|---|
| PubChem CID | 45271110 |
| Molecular Formula | C14H21N6O12P3 |
| Molecular Weight | 558.27 g/mol |
| Exact Mass | 558.04 |
| IUPAC Name | [[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-N-but-3-ynylphosphonamidic acid |
| SMILES | C#CCCNP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H21N6O12P3/c1-2-3-4-19-33(23,24)31-35(27,28)32-34(25,26)29-5-8-10(21)11(22)14(30-8)20-7-18-9-12(15)16-6-17-13(9)20/h1,6-8,10-11,14,21-22H,3-5H2,(H,25,26)(H,27,28)(H2,15,16,17)(H2,19,23,24)/t8-,10-,11-,14-/m1/s1 |
| InChIKey | YBCXDDRIWGFCTG-IDTAVKCVSA-N |
| XLogP | -1.01 |
| TPSA | 270.93 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.27 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|