C17H24N5O14P3 — CID 59701663
[[[[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hept-6-ynoate (PubChem CID 59701663) has the molecular formula C17H24N5O14P3 and a molecular weight of 615.32 g/mol. Its IUPAC name is [[[[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hept-6-ynoate.
| Compound Name | [[[[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hept-6-ynoate |
|---|---|
| PubChem CID | 59701663 |
| Molecular Formula | C17H24N5O14P3 |
| Molecular Weight | 615.32 g/mol |
| Exact Mass | 615.05 |
| IUPAC Name | [[[[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hept-6-ynoate |
| SMILES | C#CCCCCC(=O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@@H](O)C1O |
| InChI | InChI=1S/C17H24N5O14P3/c1-2-3-4-5-6-11(23)34-38(28,29)36-39(30,31)35-37(26,27)32-7-10-13(24)14(25)17(33-10)22-9-21-12-15(18)19-8-20-16(12)22/h1,8-10,13-14,17,24-25H,3-7H2,(H,26,27)(H,28,29)(H,30,31)(H2,18,19,20)/t10-,13?,14+,17-/m1/s1 |
| InChIKey | UBIWNJLEGRNJKR-WYNAFHSXSA-N |
| XLogP | 0.12 |
| TPSA | 285.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.32 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|