C18H32N5O13P3 — CID 154589591
[[(2R,4S,5R)-3,4-dihydroxy-5-(6-methylpurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy-[6-(methylamino)hexoxy]phosphoryl] hydrogen phosphate (PubChem CID 154589591) has the molecular formula C18H32N5O13P3 and a molecular weight of 619.40 g/mol. Its IUPAC name is [[(2R,4S,5R)-3,4-dihydroxy-5-(6-methylpurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy-[6-(methylamino)hexoxy]phosphoryl] hydrogen phosphate.
| Compound Name | [[(2R,4S,5R)-3,4-dihydroxy-5-(6-methylpurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy-[6-(methylamino)hexoxy]phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 154589591 |
| Molecular Formula | C18H32N5O13P3 |
| Molecular Weight | 619.40 g/mol |
| Exact Mass | 619.12 |
| IUPAC Name | [[(2R,4S,5R)-3,4-dihydroxy-5-(6-methylpurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] [hydroxy-[6-(methylamino)hexoxy]phosphoryl] hydrogen phosphate |
| SMILES | CNCCCCCCOP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(C)ncnc32)[C@@H](O)C1O |
| InChI | InChI=1S/C18H32N5O13P3/c1-12-14-17(21-10-20-12)23(11-22-14)18-16(25)15(24)13(34-18)9-33-38(28,29)36-39(30,31)35-37(26,27)32-8-6-4-3-5-7-19-2/h10-11,13,15-16,18-19,24-25H,3-9H2,1-2H3,(H,26,27)(H,28,29)(H,30,31)/t13-,15?,16+,18-/m1/s1 |
| InChIKey | WNAWWNQVMORXAF-QCXFBXDMSA-N |
| XLogP | 0.90 |
| TPSA | 254.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|