C11H13Cl2N4O5P — CID 123301430
2-(dichlorophosphoryloxymethyl)-5-(6-methylpurin-9-yl)oxolane-3,4-diol (PubChem CID 123301430) has the molecular formula C11H13Cl2N4O5P and a molecular weight of 383.13 g/mol. Its IUPAC name is 2-(dichlorophosphoryloxymethyl)-5-(6-methylpurin-9-yl)oxolane-3,4-diol.
| Compound Name | 2-(dichlorophosphoryloxymethyl)-5-(6-methylpurin-9-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 123301430 |
| Molecular Formula | C11H13Cl2N4O5P |
| Molecular Weight | 383.13 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 2-(dichlorophosphoryloxymethyl)-5-(6-methylpurin-9-yl)oxolane-3,4-diol |
| SMILES | Cc1ncnc2c1ncn2C1OC(COP(=O)(Cl)Cl)C(O)C1O |
| InChI | InChI=1S/C11H13Cl2N4O5P/c1-5-7-10(15-3-14-5)17(4-16-7)11-9(19)8(18)6(22-11)2-21-23(12,13)20/h3-4,6,8-9,11,18-19H,2H2,1H3 |
| InChIKey | GPMQCTKGRYRUPA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.13 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|