C10H10ClN4Na2O7P — CID 22556887
disodium;[5-(6-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate (PubChem CID 22556887) has the molecular formula C10H10ClN4Na2O7P and a molecular weight of 410.62 g/mol. Its IUPAC name is disodium;[5-(6-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate.
| Compound Name | disodium;[5-(6-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 22556887 |
| Molecular Formula | C10H10ClN4Na2O7P |
| Molecular Weight | 410.62 g/mol |
| Exact Mass | 409.98 |
| IUPAC Name | disodium;[5-(6-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
| SMILES | O=P([O-])([O-])OCC1OC(n2cnc3c(Cl)ncnc32)C(O)C1O.[Na+].[Na+] |
| InChI | InChI=1S/C10H12ClN4O7P.2Na/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20;;/h2-4,6-7,10,16-17H,1H2,(H2,18,19,20);;/q;2*+1/p-2 |
| InChIKey | NKZYGZUNFCOYAF-UHFFFAOYSA-L |
| XLogP | -8.05 |
| TPSA | 165.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.62 |
| LogP ≤ 5 | -8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|