C10H11ClN4O4 — CID 12810918
(2R,3R,4R,5R)-2-(6-chloropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 12810918) has the molecular formula C10H11ClN4O4 and a molecular weight of 288.66 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-(6-chloropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-(6-chloropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 12810918 |
| Molecular Formula | C10H11ClN4O4 |
| Molecular Weight | 288.66 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | (2R,3R,4R,5R)-2-(6-chloropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(Cl)[15n]c[15n]c32)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H11ClN4O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2/t4-,6+,7-,10-/m1/s1/i12+1,13+1 |
| InChIKey | XHRJGHCQQPETRH-YOGAZPCDSA-N |
| XLogP | -0.91 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.66 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |