C10H11IN4O4 — CID 18661222
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-iodopurin-9-yl)oxolane-3,4-diol (PubChem CID 18661222) has the molecular formula C10H11IN4O4 and a molecular weight of 378.13 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-iodopurin-9-yl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-iodopurin-9-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 18661222 |
| Molecular Formula | C10H11IN4O4 |
| Molecular Weight | 378.13 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-iodopurin-9-yl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(I)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H11IN4O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2/t4-,6-,7-,10-/m1/s1 |
| InChIKey | UNZAHOOMFIAZES-KQYNXXCUSA-N |
| XLogP | -0.96 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.13 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|