C12H11ClN4O2 — CID 53375978
[(1S,2S,4R,5R)-4-(6-chloropurin-9-yl)-3-oxabicyclo[3.2.0]hept-6-en-2-yl]methanol (PubChem CID 53375978) has the molecular formula C12H11ClN4O2 and a molecular weight of 278.70 g/mol. Its IUPAC name is [(1S,2S,4R,5R)-4-(6-chloropurin-9-yl)-3-oxabicyclo[3.2.0]hept-6-en-2-yl]methanol.
| Compound Name | [(1S,2S,4R,5R)-4-(6-chloropurin-9-yl)-3-oxabicyclo[3.2.0]hept-6-en-2-yl]methanol |
|---|---|
| PubChem CID | 53375978 |
| Molecular Formula | C12H11ClN4O2 |
| Molecular Weight | 278.70 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | [(1S,2S,4R,5R)-4-(6-chloropurin-9-yl)-3-oxabicyclo[3.2.0]hept-6-en-2-yl]methanol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(Cl)ncnc32)[C@@H]2C=C[C@@H]21 |
| InChI | InChI=1S/C12H11ClN4O2/c13-10-9-11(15-4-14-10)17(5-16-9)12-7-2-1-6(7)8(3-18)19-12/h1-2,4-8,12,18H,3H2/t6-,7+,8+,12+/m0/s1 |
| InChIKey | LZCFQOSOKLKLNH-HIHLCYOISA-N |
| XLogP | 1.17 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.70 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|