C21H25ClN4O5 — CID 143846604
[(3aR,6R,6aR)-4-(6-chloropurin-9-yl)-2-(4-methoxyphenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol;propane (PubChem CID 143846604) has the molecular formula C21H25ClN4O5 and a molecular weight of 448.91 g/mol. Its IUPAC name is [(3aR,6R,6aR)-4-(6-chloropurin-9-yl)-2-(4-methoxyphenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol;propane.
| Compound Name | [(3aR,6R,6aR)-4-(6-chloropurin-9-yl)-2-(4-methoxyphenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol;propane |
|---|---|
| PubChem CID | 143846604 |
| Molecular Formula | C21H25ClN4O5 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | [(3aR,6R,6aR)-4-(6-chloropurin-9-yl)-2-(4-methoxyphenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol;propane |
| SMILES | CCC.COc1ccc(C2O[C@@H]3[C@@H](CO)OC(n4cnc5c(Cl)ncnc54)[C@@H]3O2)cc1 |
| InChI | InChI=1S/C18H17ClN4O5.C3H8/c1-25-10-4-2-9(3-5-10)18-27-13-11(6-24)26-17(14(13)28-18)23-8-22-12-15(19)20-7-21-16(12)23;1-3-2/h2-5,7-8,11,13-14,17-18,24H,6H2,1H3;3H2,1-2H3/t11-,13-,14-,17?,18?;/m1./s1 |
| InChIKey | HMJZYCMJPMWUTI-HHHSZAMESA-N |
| XLogP | 3.28 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |