C18H19N5O6 — CID 135665264
2-amino-9-[6-(hydroxymethyl)-2-(4-methoxyphenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1H-purin-6-one (PubChem CID 135665264) has the molecular formula C18H19N5O6 and a molecular weight of 401.38 g/mol. Its IUPAC name is 2-amino-9-[6-(hydroxymethyl)-2-(4-methoxyphenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[6-(hydroxymethyl)-2-(4-methoxyphenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135665264 |
| Molecular Formula | C18H19N5O6 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-amino-9-[6-(hydroxymethyl)-2-(4-methoxyphenyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1H-purin-6-one |
| SMILES | COc1ccc(C2OC3C(CO)OC(n4cnc5c(=O)[nH]c(N)nc54)C3O2)cc1 |
| InChI | InChI=1S/C18H19N5O6/c1-26-9-4-2-8(3-5-9)17-28-12-10(6-24)27-16(13(12)29-17)23-7-20-11-14(23)21-18(19)22-15(11)25/h2-5,7,10,12-13,16-17,24H,6H2,1H3,(H3,19,21,22,25) |
| InChIKey | IPNIAJRSLVXLTJ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 146.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |