C17H17N5O5 — CID 135432256
9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-amino-1H-purin-6-one (PubChem CID 135432256) has the molecular formula C17H17N5O5 and a molecular weight of 371.35 g/mol. Its IUPAC name is 9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-amino-1H-purin-6-one.
| Compound Name | 9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-amino-1H-purin-6-one |
|---|---|
| PubChem CID | 135432256 |
| Molecular Formula | C17H17N5O5 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-amino-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](CO)[C@H]3OC(c4ccccc4)O[C@H]32)c(=O)[nH]1 |
| InChI | InChI=1S/C17H17N5O5/c18-17-20-13-10(14(24)21-17)19-7-22(13)15-12-11(9(6-23)25-15)26-16(27-12)8-4-2-1-3-5-8/h1-5,7,9,11-12,15-16,23H,6H2,(H3,18,20,21,24)/t9-,11-,12-,15-,16?/m1/s1 |
| InChIKey | HEDMJUXVPMZAIO-IVZLEWBYSA-N |
| XLogP | 0.07 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |