C10H12BaN5O7P+2 — CID 135534510
2-amino-9-[2-hydroxy-6-(hydroxymethyl)-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-4-yl]-1H-purin-6-one;barium(2+) (PubChem CID 135534510) has the molecular formula C10H12BaN5O7P+2 and a molecular weight of 482.54 g/mol. Its IUPAC name is 2-amino-9-[2-hydroxy-6-(hydroxymethyl)-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-4-yl]-1H-purin-6-one;barium(2+).
| Compound Name | 2-amino-9-[2-hydroxy-6-(hydroxymethyl)-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-4-yl]-1H-purin-6-one;barium(2+) |
|---|---|
| PubChem CID | 135534510 |
| Molecular Formula | C10H12BaN5O7P+2 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.95 |
| IUPAC Name | 2-amino-9-[2-hydroxy-6-(hydroxymethyl)-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-4-yl]-1H-purin-6-one;barium(2+) |
| SMILES | Nc1nc2c(ncn2C2OC(CO)C3OP(=O)(O)OC32)c(=O)[nH]1.[Ba+2] |
| InChI | InChI=1S/C10H12N5O7P.Ba/c11-10-13-7-4(8(17)14-10)12-2-15(7)9-6-5(3(1-16)20-9)21-23(18,19)22-6;/h2-3,5-6,9,16H,1H2,(H,18,19)(H3,11,13,14,17);/q;+2 |
| InChIKey | YELKQOKFHXHKJB-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 174.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|