C25H23N5O6 — CID 57327207
benzyl N-[9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]carbamate (PubChem CID 57327207) has the molecular formula C25H23N5O6 and a molecular weight of 489.49 g/mol. Its IUPAC name is benzyl N-[9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]carbamate.
| Compound Name | benzyl N-[9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]carbamate |
|---|---|
| PubChem CID | 57327207 |
| Molecular Formula | C25H23N5O6 |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | benzyl N-[9-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-yl]carbamate |
| SMILES | O=C(Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@H]2OC(c3ccccc3)O[C@H]21)OCc1ccccc1 |
| InChI | InChI=1S/C25H23N5O6/c31-11-17-19-20(36-24(35-19)16-9-5-2-6-10-16)23(34-17)30-14-28-18-21(26-13-27-22(18)30)29-25(32)33-12-15-7-3-1-4-8-15/h1-10,13-14,17,19-20,23-24,31H,11-12H2,(H,26,27,29,32)/t17-,19-,20-,23-,24?/m1/s1 |
| InChIKey | BBXLKFXBSQLRTG-LNTKWDIKSA-N |
| XLogP | 2.95 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |