C22H25N5O5 — CID 71094087
4-[(3aR,6R,6aR)-4-[6-(cyclopentylamino)purin-9-yl]-6-(hydroxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-2-yl]phenol (PubChem CID 71094087) has the molecular formula C22H25N5O5 and a molecular weight of 439.47 g/mol. Its IUPAC name is 4-[(3aR,6R,6aR)-4-[6-(cyclopentylamino)purin-9-yl]-6-(hydroxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-2-yl]phenol.
| Compound Name | 4-[(3aR,6R,6aR)-4-[6-(cyclopentylamino)purin-9-yl]-6-(hydroxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-2-yl]phenol |
|---|---|
| PubChem CID | 71094087 |
| Molecular Formula | C22H25N5O5 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 4-[(3aR,6R,6aR)-4-[6-(cyclopentylamino)purin-9-yl]-6-(hydroxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-2-yl]phenol |
| SMILES | OC[C@H]1OC(n2cnc3c(NC4CCCC4)ncnc32)[C@@H]2OC(c3ccc(O)cc3)O[C@H]12 |
| InChI | InChI=1S/C22H25N5O5/c28-9-15-17-18(32-22(31-17)12-5-7-14(29)8-6-12)21(30-15)27-11-25-16-19(23-10-24-20(16)27)26-13-3-1-2-4-13/h5-8,10-11,13,15,17-18,21-22,28-29H,1-4,9H2,(H,23,24,26)/t15-,17-,18-,21?,22?/m1/s1 |
| InChIKey | VMONQKSSXFODMB-VVAUGKOFSA-N |
| XLogP | 2.26 |
| TPSA | 123.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |