C16H23N5O3 — CID 76777733
2-[6-(cyclopentylamino)purin-9-yl]-5-ethyloxolane-3,4-diol (PubChem CID 76777733) has the molecular formula C16H23N5O3 and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-[6-(cyclopentylamino)purin-9-yl]-5-ethyloxolane-3,4-diol.
| Compound Name | 2-[6-(cyclopentylamino)purin-9-yl]-5-ethyloxolane-3,4-diol |
|---|---|
| PubChem CID | 76777733 |
| Molecular Formula | C16H23N5O3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 2-[6-(cyclopentylamino)purin-9-yl]-5-ethyloxolane-3,4-diol |
| SMILES | CCC1OC(n2cnc3c(NC4CCCC4)ncnc32)C(O)C1O |
| InChI | InChI=1S/C16H23N5O3/c1-2-10-12(22)13(23)16(24-10)21-8-19-11-14(17-7-18-15(11)21)20-9-5-3-4-6-9/h7-10,12-13,16,22-23H,2-6H2,1H3,(H,17,18,20) |
| InChIKey | JINVIIJODLXFHF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |