C15H21N5O6S — CID 53390268
[(2R,3S,4R,5R)-5-[6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl hydrogen sulfite (PubChem CID 53390268) has the molecular formula C15H21N5O6S and a molecular weight of 399.43 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl hydrogen sulfite.
| Compound Name | [(2R,3S,4R,5R)-5-[6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl hydrogen sulfite |
|---|---|
| PubChem CID | 53390268 |
| Molecular Formula | C15H21N5O6S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[6-(cyclopentylamino)purin-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl hydrogen sulfite |
| SMILES | O=S(O)OC[C@H]1O[C@@H](n2cnc3c(NC4CCCC4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H21N5O6S/c21-11-9(5-25-27(23)24)26-15(12(11)22)20-7-18-10-13(16-6-17-14(10)20)19-8-3-1-2-4-8/h6-9,11-12,15,21-22H,1-5H2,(H,23,24)(H,16,17,19)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | DXCGQERZRKYJQW-SDBHATRESA-N |
| XLogP | -0.05 |
| TPSA | 151.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|