C15H20ClN5O4 — CID 16656271
(2S,3S,4R,5R)-2-(chloromethyl)-5-[6-[[(1R,2R)-2-hydroxycyclopentyl]amino]purin-9-yl]oxolane-3,4-diol (PubChem CID 16656271) has the molecular formula C15H20ClN5O4 and a molecular weight of 369.81 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-(chloromethyl)-5-[6-[[(1R,2R)-2-hydroxycyclopentyl]amino]purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2S,3S,4R,5R)-2-(chloromethyl)-5-[6-[[(1R,2R)-2-hydroxycyclopentyl]amino]purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 16656271 |
| Molecular Formula | C15H20ClN5O4 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (2S,3S,4R,5R)-2-(chloromethyl)-5-[6-[[(1R,2R)-2-hydroxycyclopentyl]amino]purin-9-yl]oxolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H](CCl)O[C@H]1n1cnc2c(N[C@@H]3CCC[C@H]3O)ncnc21 |
| InChI | InChI=1S/C15H20ClN5O4/c16-4-9-11(23)12(24)15(25-9)21-6-19-10-13(17-5-18-14(10)21)20-7-2-1-3-8(7)22/h5-9,11-12,15,22-24H,1-4H2,(H,17,18,20)/t7-,8-,9-,11-,12-,15-/m1/s1 |
| InChIKey | OHEWMLNLJBLPPD-QDYOZFCWSA-N |
| XLogP | 0.01 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|