C15H20N6O7 — CID 59789654
[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[[(1R,2S)-2-hydroxycyclopentyl]amino]purin-9-yl]oxolan-2-yl]methyl nitrate (PubChem CID 59789654) has the molecular formula C15H20N6O7 and a molecular weight of 396.36 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[[(1R,2S)-2-hydroxycyclopentyl]amino]purin-9-yl]oxolan-2-yl]methyl nitrate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[[(1R,2S)-2-hydroxycyclopentyl]amino]purin-9-yl]oxolan-2-yl]methyl nitrate |
|---|---|
| PubChem CID | 59789654 |
| Molecular Formula | C15H20N6O7 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-[[(1R,2S)-2-hydroxycyclopentyl]amino]purin-9-yl]oxolan-2-yl]methyl nitrate |
| SMILES | O=[N+]([O-])OC[C@H]1O[C@@H](n2cnc3c(N[C@@H]4CCC[C@@H]4O)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H20N6O7/c22-8-3-1-2-7(8)19-13-10-14(17-5-16-13)20(6-18-10)15-12(24)11(23)9(28-15)4-27-21(25)26/h5-9,11-12,15,22-24H,1-4H2,(H,16,17,19)/t7-,8+,9-,11-,12-,15-/m1/s1 |
| InChIKey | NTTXJWBNZWQWED-CYZRSLADSA-N |
| XLogP | -1.02 |
| TPSA | 177.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|