C15H21N5O3S — CID 137454747
(2R,3R,4S,5S)-2-[6-(cyclopentylamino)purin-9-yl]-5-(sulfanylmethyl)oxolane-3,4-diol (PubChem CID 137454747) has the molecular formula C15H21N5O3S and a molecular weight of 351.43 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[6-(cyclopentylamino)purin-9-yl]-5-(sulfanylmethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-[6-(cyclopentylamino)purin-9-yl]-5-(sulfanylmethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 137454747 |
| Molecular Formula | C15H21N5O3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | (2R,3R,4S,5S)-2-[6-(cyclopentylamino)purin-9-yl]-5-(sulfanylmethyl)oxolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H](CS)O[C@H]1n1cnc2c(NC3CCCC3)ncnc21 |
| InChI | InChI=1S/C15H21N5O3S/c21-11-9(5-24)23-15(12(11)22)20-7-18-10-13(16-6-17-14(10)20)19-8-3-1-2-4-8/h6-9,11-12,15,21-22,24H,1-5H2,(H,16,17,19)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | UPSYRZMHHZNMCO-SDBHATRESA-N |
| XLogP | 0.73 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|